C23H39NO2 — CID 67764127
3-methyl-1-[(Z)-octadec-9-enyl]pyrrole-2,5-dione (PubChem CID 67764127) has the molecular formula C23H39NO2 and a molecular weight of 361.57 g/mol. Its IUPAC name is 3-methyl-1-[(Z)-octadec-9-enyl]pyrrole-2,5-dione.
| Compound Name | 3-methyl-1-[(Z)-octadec-9-enyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 67764127 |
| Molecular Formula | C23H39NO2 |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 361.30 |
| IUPAC Name | 3-methyl-1-[(Z)-octadec-9-enyl]pyrrole-2,5-dione |
| SMILES | CCCCCCCC/C=C\CCCCCCCCN1C(=O)C=C(C)C1=O |
| InChI | InChI=1S/C23H39NO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24-22(25)20-21(2)23(24)26/h10-11,20H,3-9,12-19H2,1-2H3/b11-10- |
| InChIKey | DUVFOVCOBLIEBK-KHPPLWFESA-N |
| XLogP | 6.34 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|