C17H18N2O6 — CID 58898523
3-methyl-1-[7-(3-methyl-2,5-dioxopyrrol-1-yl)-2,6-dioxoheptyl]pyrrole-2,5-dione (PubChem CID 58898523) has the molecular formula C17H18N2O6 and a molecular weight of 346.34 g/mol. Its IUPAC name is 3-methyl-1-[7-(3-methyl-2,5-dioxopyrrol-1-yl)-2,6-dioxoheptyl]pyrrole-2,5-dione.
| Compound Name | 3-methyl-1-[7-(3-methyl-2,5-dioxopyrrol-1-yl)-2,6-dioxoheptyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 58898523 |
| Molecular Formula | C17H18N2O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 3-methyl-1-[7-(3-methyl-2,5-dioxopyrrol-1-yl)-2,6-dioxoheptyl]pyrrole-2,5-dione |
| SMILES | CC1=CC(=O)N(CC(=O)CCCC(=O)CN2C(=O)C=C(C)C2=O)C1=O |
| InChI | InChI=1S/C17H18N2O6/c1-10-6-14(22)18(16(10)24)8-12(20)4-3-5-13(21)9-19-15(23)7-11(2)17(19)25/h6-7H,3-5,8-9H2,1-2H3 |
| InChIKey | WZOIFPOUMBREBN-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|