C9H11NO5 — CID 66171632
2-hydroxy-2-methyl-3-(3-methyl-2,5-dioxopyrrol-1-yl)propanoic acid (PubChem CID 66171632) has the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-3-(3-methyl-2,5-dioxopyrrol-1-yl)propanoic acid.
| Compound Name | 2-hydroxy-2-methyl-3-(3-methyl-2,5-dioxopyrrol-1-yl)propanoic acid |
|---|---|
| PubChem CID | 66171632 |
| Molecular Formula | C9H11NO5 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 2-hydroxy-2-methyl-3-(3-methyl-2,5-dioxopyrrol-1-yl)propanoic acid |
| SMILES | CC1=CC(=O)N(CC(C)(O)C(=O)O)C1=O |
| InChI | InChI=1S/C9H11NO5/c1-5-3-6(11)10(7(5)12)4-9(2,15)8(13)14/h3,15H,4H2,1-2H3,(H,13,14) |
| InChIKey | CFGUCIMYJKZBJY-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|