C8H8FNO4 — CID 167333245
2-fluoro-3-(3-methyl-2,5-dioxopyrrol-1-yl)propanoic acid (PubChem CID 167333245) has the molecular formula C8H8FNO4 and a molecular weight of 201.15 g/mol. Its IUPAC name is 2-fluoro-3-(3-methyl-2,5-dioxopyrrol-1-yl)propanoic acid.
| Compound Name | 2-fluoro-3-(3-methyl-2,5-dioxopyrrol-1-yl)propanoic acid |
|---|---|
| PubChem CID | 167333245 |
| Molecular Formula | C8H8FNO4 |
| Molecular Weight | 201.15 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 2-fluoro-3-(3-methyl-2,5-dioxopyrrol-1-yl)propanoic acid |
| SMILES | CC1=CC(=O)N(CC(F)C(=O)O)C1=O |
| InChI | InChI=1S/C8H8FNO4/c1-4-2-6(11)10(7(4)12)3-5(9)8(13)14/h2,5H,3H2,1H3,(H,13,14) |
| InChIKey | KVESLZBBKWTPLQ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.15 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|