C8H7FNO4- — CID 167333244
2-fluoro-3-(3-methyl-2,5-dioxopyrrol-1-yl)propanoate (PubChem CID 167333244) has the molecular formula C8H7FNO4- and a molecular weight of 200.14 g/mol. Its IUPAC name is 2-fluoro-3-(3-methyl-2,5-dioxopyrrol-1-yl)propanoate.
| Compound Name | 2-fluoro-3-(3-methyl-2,5-dioxopyrrol-1-yl)propanoate |
|---|---|
| PubChem CID | 167333244 |
| Molecular Formula | C8H7FNO4- |
| Molecular Weight | 200.14 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 2-fluoro-3-(3-methyl-2,5-dioxopyrrol-1-yl)propanoate |
| SMILES | CC1=CC(=O)N(CC(F)C(=O)[O-])C1=O |
| InChI | InChI=1S/C8H8FNO4/c1-4-2-6(11)10(7(4)12)3-5(9)8(13)14/h2,5H,3H2,1H3,(H,13,14)/p-1 |
| InChIKey | KVESLZBBKWTPLQ-UHFFFAOYSA-M |
| XLogP | -1.61 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.14 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|