C7H5FNO4- — CID 167333145
3-(2,5-dioxopyrrol-1-yl)-2-fluoropropanoate (PubChem CID 167333145) has the molecular formula C7H5FNO4- and a molecular weight of 186.12 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-2-fluoropropanoate.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-2-fluoropropanoate |
|---|---|
| PubChem CID | 167333145 |
| Molecular Formula | C7H5FNO4- |
| Molecular Weight | 186.12 g/mol |
| Exact Mass | 186.02 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-2-fluoropropanoate |
| SMILES | O=C([O-])C(F)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C7H6FNO4/c8-4(7(12)13)3-9-5(10)1-2-6(9)11/h1-2,4H,3H2,(H,12,13)/p-1 |
| InChIKey | JCTDQCYCKLMWIV-UHFFFAOYSA-M |
| XLogP | -2.00 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.12 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|