C10H11NO5 — CID 87214553
propanoyl 3-(2,5-dioxopyrrol-1-yl)propanoate (PubChem CID 87214553) has the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. Its IUPAC name is propanoyl 3-(2,5-dioxopyrrol-1-yl)propanoate.
| Compound Name | propanoyl 3-(2,5-dioxopyrrol-1-yl)propanoate |
|---|---|
| PubChem CID | 87214553 |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | propanoyl 3-(2,5-dioxopyrrol-1-yl)propanoate |
| SMILES | CCC(=O)OC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H11NO5/c1-2-9(14)16-10(15)5-6-11-7(12)3-4-8(11)13/h3-4H,2,5-6H2,1H3 |
| InChIKey | FPYPTZIHDSMVBP-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|