C14H23NO6 — CID 57209303
1-[2,2-dimethoxy-2-(2-methylbutan-2-ylperoxy)ethyl]-3-methylpyrrole-2,5-dione (PubChem CID 57209303) has the molecular formula C14H23NO6 and a molecular weight of 301.34 g/mol. Its IUPAC name is 1-[2,2-dimethoxy-2-(2-methylbutan-2-ylperoxy)ethyl]-3-methylpyrrole-2,5-dione.
| Compound Name | 1-[2,2-dimethoxy-2-(2-methylbutan-2-ylperoxy)ethyl]-3-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 57209303 |
| Molecular Formula | C14H23NO6 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 1-[2,2-dimethoxy-2-(2-methylbutan-2-ylperoxy)ethyl]-3-methylpyrrole-2,5-dione |
| SMILES | CCC(C)(C)OOC(CN1C(=O)C=C(C)C1=O)(OC)OC |
| InChI | InChI=1S/C14H23NO6/c1-7-13(3,4)20-21-14(18-5,19-6)9-15-11(16)8-10(2)12(15)17/h8H,7,9H2,1-6H3 |
| InChIKey | OXZZOWQDWVQGMZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|