C30H42O8 — CID 139692779
2-phenylpropan-2-yl 3-methyl-2-[2-[3-methyl-1-oxo-1-(2-phenylpropan-2-ylperoxy)butan-2-yl]oxyethoxy]butaneperoxoate (PubChem CID 139692779) has the molecular formula C30H42O8 and a molecular weight of 530.66 g/mol. Its IUPAC name is 2-phenylpropan-2-yl 3-methyl-2-[2-[3-methyl-1-oxo-1-(2-phenylpropan-2-ylperoxy)butan-2-yl]oxyethoxy]butaneperoxoate.
| Compound Name | 2-phenylpropan-2-yl 3-methyl-2-[2-[3-methyl-1-oxo-1-(2-phenylpropan-2-ylperoxy)butan-2-yl]oxyethoxy]butaneperoxoate |
|---|---|
| PubChem CID | 139692779 |
| Molecular Formula | C30H42O8 |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | 2-phenylpropan-2-yl 3-methyl-2-[2-[3-methyl-1-oxo-1-(2-phenylpropan-2-ylperoxy)butan-2-yl]oxyethoxy]butaneperoxoate |
| SMILES | CC(C)C(OCCOC(C(=O)OOC(C)(C)c1ccccc1)C(C)C)C(=O)OOC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C30H42O8/c1-21(2)25(27(31)35-37-29(5,6)23-15-11-9-12-16-23)33-19-20-34-26(22(3)4)28(32)36-38-30(7,8)24-17-13-10-14-18-24/h9-18,21-22,25-26H,19-20H2,1-8H3 |
| InChIKey | PMGINQJEKRGNNR-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|