C16H17NO6 — CID 154448019
2-phenylpropan-2-yloxy 2-(3-methyl-2,5-dioxopyrrol-1-yl)ethaneperoxoate (PubChem CID 154448019) has the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. Its IUPAC name is 2-phenylpropan-2-yloxy 2-(3-methyl-2,5-dioxopyrrol-1-yl)ethaneperoxoate.
| Compound Name | 2-phenylpropan-2-yloxy 2-(3-methyl-2,5-dioxopyrrol-1-yl)ethaneperoxoate |
|---|---|
| PubChem CID | 154448019 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 2-phenylpropan-2-yloxy 2-(3-methyl-2,5-dioxopyrrol-1-yl)ethaneperoxoate |
| SMILES | CC1=CC(=O)N(CC(=O)OOOC(C)(C)c2ccccc2)C1=O |
| InChI | InChI=1S/C16H17NO6/c1-11-9-13(18)17(15(11)20)10-14(19)21-23-22-16(2,3)12-7-5-4-6-8-12/h4-9H,10H2,1-3H3 |
| InChIKey | JEUJXIAWOIBOGJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|