C14H22N2O5 — CID 115947468
methyl 2-(5,5-diethyl-2,4,6-trioxo-1,3-diazinan-1-yl)-3-methylbutanoate (PubChem CID 115947468) has the molecular formula C14H22N2O5 and a molecular weight of 298.34 g/mol. Its IUPAC name is methyl 2-(5,5-diethyl-2,4,6-trioxo-1,3-diazinan-1-yl)-3-methylbutanoate.
| Compound Name | methyl 2-(5,5-diethyl-2,4,6-trioxo-1,3-diazinan-1-yl)-3-methylbutanoate |
|---|---|
| PubChem CID | 115947468 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | methyl 2-(5,5-diethyl-2,4,6-trioxo-1,3-diazinan-1-yl)-3-methylbutanoate |
| SMILES | CCC1(CC)C(=O)NC(=O)N(C(C(=O)OC)C(C)C)C1=O |
| InChI | InChI=1S/C14H22N2O5/c1-6-14(7-2)11(18)15-13(20)16(12(14)19)9(8(3)4)10(17)21-5/h8-9H,6-7H2,1-5H3,(H,15,18,20) |
| InChIKey | LYKORBIABNCNFV-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|