C13H20N2O4S — CID 81336396
2-[5-ethyl-1-(1-methoxy-3-methyl-1-oxobutan-2-yl)imidazol-2-yl]sulfanylacetic acid (PubChem CID 81336396) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-[5-ethyl-1-(1-methoxy-3-methyl-1-oxobutan-2-yl)imidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[5-ethyl-1-(1-methoxy-3-methyl-1-oxobutan-2-yl)imidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 81336396 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-[5-ethyl-1-(1-methoxy-3-methyl-1-oxobutan-2-yl)imidazol-2-yl]sulfanylacetic acid |
| SMILES | CCc1cnc(SCC(=O)O)n1C(C(=O)OC)C(C)C |
| InChI | InChI=1S/C13H20N2O4S/c1-5-9-6-14-13(20-7-10(16)17)15(9)11(8(2)3)12(18)19-4/h6,8,11H,5,7H2,1-4H3,(H,16,17) |
| InChIKey | JUVYFLBBHYREOZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |