C14H18N2O2S2 — CID 81336894
2-[5-ethyl-1-(1-thiophen-3-ylpropan-2-yl)imidazol-2-yl]sulfanylacetic acid (PubChem CID 81336894) has the molecular formula C14H18N2O2S2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 2-[5-ethyl-1-(1-thiophen-3-ylpropan-2-yl)imidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[5-ethyl-1-(1-thiophen-3-ylpropan-2-yl)imidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 81336894 |
| Molecular Formula | C14H18N2O2S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-[5-ethyl-1-(1-thiophen-3-ylpropan-2-yl)imidazol-2-yl]sulfanylacetic acid |
| SMILES | CCc1cnc(SCC(=O)O)n1C(C)Cc1ccsc1 |
| InChI | InChI=1S/C14H18N2O2S2/c1-3-12-7-15-14(20-9-13(17)18)16(12)10(2)6-11-4-5-19-8-11/h4-5,7-8,10H,3,6,9H2,1-2H3,(H,17,18) |
| InChIKey | NAZKUPDFKCRSFT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |