C14H24N2O3 — CID 112600385
5,5-diethyl-1-hexan-3-yl-1,3-diazinane-2,4,6-trione (PubChem CID 112600385) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is 5,5-diethyl-1-hexan-3-yl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5,5-diethyl-1-hexan-3-yl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 112600385 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 5,5-diethyl-1-hexan-3-yl-1,3-diazinane-2,4,6-trione |
| SMILES | CCCC(CC)N1C(=O)NC(=O)C(CC)(CC)C1=O |
| InChI | InChI=1S/C14H24N2O3/c1-5-9-10(6-2)16-12(18)14(7-3,8-4)11(17)15-13(16)19/h10H,5-9H2,1-4H3,(H,15,17,19) |
| InChIKey | GEDRFZXRYWFCFQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|