C13H17N3O3S — CID 115947705
1-(4,5-dimethyl-1,3-thiazol-2-yl)-5,5-diethyl-1,3-diazinane-2,4,6-trione (PubChem CID 115947705) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is 1-(4,5-dimethyl-1,3-thiazol-2-yl)-5,5-diethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(4,5-dimethyl-1,3-thiazol-2-yl)-5,5-diethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 115947705 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 1-(4,5-dimethyl-1,3-thiazol-2-yl)-5,5-diethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCC1(CC)C(=O)NC(=O)N(c2nc(C)c(C)s2)C1=O |
| InChI | InChI=1S/C13H17N3O3S/c1-5-13(6-2)9(17)15-11(19)16(10(13)18)12-14-7(3)8(4)20-12/h5-6H2,1-4H3,(H,15,17,19) |
| InChIKey | SQNUACJLGICJBA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|