C13H18N4O3 — CID 115946872
5,5-diethyl-1-(1-ethylpyrazol-4-yl)-1,3-diazinane-2,4,6-trione (PubChem CID 115946872) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is 5,5-diethyl-1-(1-ethylpyrazol-4-yl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5,5-diethyl-1-(1-ethylpyrazol-4-yl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 115946872 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 5,5-diethyl-1-(1-ethylpyrazol-4-yl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCn1cc(N2C(=O)NC(=O)C(CC)(CC)C2=O)cn1 |
| InChI | InChI=1S/C13H18N4O3/c1-4-13(5-2)10(18)15-12(20)17(11(13)19)9-7-14-16(6-3)8-9/h7-8H,4-6H2,1-3H3,(H,15,18,20) |
| InChIKey | IFQZEQZSROHYPY-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|