C12H18N4O2 — CID 64961125
1-(1-ethylpyrazol-4-yl)-3,3-dimethyl-1,4-diazepane-2,5-dione (PubChem CID 64961125) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 1-(1-ethylpyrazol-4-yl)-3,3-dimethyl-1,4-diazepane-2,5-dione.
| Compound Name | 1-(1-ethylpyrazol-4-yl)-3,3-dimethyl-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 64961125 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 1-(1-ethylpyrazol-4-yl)-3,3-dimethyl-1,4-diazepane-2,5-dione |
| SMILES | CCn1cc(N2CCC(=O)NC(C)(C)C2=O)cn1 |
| InChI | InChI=1S/C12H18N4O2/c1-4-15-8-9(7-13-15)16-6-5-10(17)14-12(2,3)11(16)18/h7-8H,4-6H2,1-3H3,(H,14,17) |
| InChIKey | LWZITXBQRJJORA-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |