C13H22N2O5S — CID 115948672
5,5-diethyl-1-(2-methyl-2-methylsulfonylpropyl)-1,3-diazinane-2,4,6-trione (PubChem CID 115948672) has the molecular formula C13H22N2O5S and a molecular weight of 318.40 g/mol. Its IUPAC name is 5,5-diethyl-1-(2-methyl-2-methylsulfonylpropyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5,5-diethyl-1-(2-methyl-2-methylsulfonylpropyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 115948672 |
| Molecular Formula | C13H22N2O5S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 5,5-diethyl-1-(2-methyl-2-methylsulfonylpropyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCC1(CC)C(=O)NC(=O)N(CC(C)(C)S(C)(=O)=O)C1=O |
| InChI | InChI=1S/C13H22N2O5S/c1-6-13(7-2)9(16)14-11(18)15(10(13)17)8-12(3,4)21(5,19)20/h6-8H2,1-5H3,(H,14,16,18) |
| InChIKey | LQENILSCWGVJAO-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|