C8H14N2O4S — CID 103936214
3-(2-methyl-2-methylsulfonylpropyl)imidazolidine-2,4-dione (PubChem CID 103936214) has the molecular formula C8H14N2O4S and a molecular weight of 234.28 g/mol. Its IUPAC name is 3-(2-methyl-2-methylsulfonylpropyl)imidazolidine-2,4-dione.
| Compound Name | 3-(2-methyl-2-methylsulfonylpropyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 103936214 |
| Molecular Formula | C8H14N2O4S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 3-(2-methyl-2-methylsulfonylpropyl)imidazolidine-2,4-dione |
| SMILES | CC(C)(CN1C(=O)CNC1=O)S(C)(=O)=O |
| InChI | InChI=1S/C8H14N2O4S/c1-8(2,15(3,13)14)5-10-6(11)4-9-7(10)12/h4-5H2,1-3H3,(H,9,12) |
| InChIKey | ZFPJWMJFQXUTLS-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|