About 3-(4-hydroxy-2,2-dimethylbutyl)imidazolidine-2,4-dione
3-(4-hydroxy-2,2-dimethylbutyl)imidazolidine-2,4-dione (PubChem CID 103936481) has the molecular formula C9H16N2O3
and a molecular weight of 200.24 g/mol. Its IUPAC name is 3-(4-hydroxy-2,2-dimethylbutyl)imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 3-(4-hydroxy-2,2-dimethylbutyl)imidazolidine-2,4-dione |
| PubChem CID | 103936481 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 3-(4-hydroxy-2,2-dimethylbutyl)imidazolidine-2,4-dione |
| SMILES | CC(C)(CCO)CN1C(=O)CNC1=O |
| InChI | InChI=1S/C9H16N2O3/c1-9(2,3-4-12)6-11-7(13)5-10-8(11)14/h12H,3-6H2,1-2H3,(H,10,14) |
| InChIKey | QGJKUUVQUKXHNC-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-hydroxy-2,2-dimethylbutyl)imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-hydroxy-2,2-dimethylbutyl)imidazolidine-2,4-dione?
The IUPAC name of 3-(4-hydroxy-2,2-dimethylbutyl)imidazolidine-2,4-dione (CID 103936481) is 3-(4-hydroxy-2,2-dimethylbutyl)imidazolidine-2,4-dione.
What is the SMILES notation for 3-(4-hydroxy-2,2-dimethylbutyl)imidazolidine-2,4-dione?
The canonical SMILES for 3-(4-hydroxy-2,2-dimethylbutyl)imidazolidine-2,4-dione is CC(C)(CCO)CN1C(=O)CNC1=O.
What is the InChIKey of 3-(4-hydroxy-2,2-dimethylbutyl)imidazolidine-2,4-dione?
The InChIKey is QGJKUUVQUKXHNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O3/c1-9(2,3-4-12)6-11-7(13)5-10-8(11)14/h12H,3-6H2,1-2H3,(H,10,14).
What are the key properties of 3-(4-hydroxy-2,2-dimethylbutyl)imidazolidine-2,4-dione?
3-(4-hydroxy-2,2-dimethylbutyl)imidazolidine-2,4-dione has a molecular weight of 200.24 g/mol, XLogP of -0.05, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-hydroxy-2,2-dimethylbutyl)imidazolidine-2,4-dione is sourced from PubChem (CID 103936481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).