C15H19N3O3 — CID 114958047
5,5-diethyl-1-[(4-methyl-3-pyridinyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 114958047) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 5,5-diethyl-1-[(4-methyl-3-pyridinyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5,5-diethyl-1-[(4-methyl-3-pyridinyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 114958047 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 5,5-diethyl-1-[(4-methyl-3-pyridinyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CCC1(CC)C(=O)NC(=O)N(Cc2cnccc2C)C1=O |
| InChI | InChI=1S/C15H19N3O3/c1-4-15(5-2)12(19)17-14(21)18(13(15)20)9-11-8-16-7-6-10(11)3/h6-8H,4-5,9H2,1-3H3,(H,17,19,21) |
| InChIKey | FBJAUFQEOXQNMJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|