C11H16N2O6 — CID 141140179
1-(2,3-dihydroxypropanoyl)-5,5-diethyl-1,3-diazinane-2,4,6-trione (PubChem CID 141140179) has the molecular formula C11H16N2O6 and a molecular weight of 272.26 g/mol. Its IUPAC name is 1-(2,3-dihydroxypropanoyl)-5,5-diethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(2,3-dihydroxypropanoyl)-5,5-diethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 141140179 |
| Molecular Formula | C11H16N2O6 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 1-(2,3-dihydroxypropanoyl)-5,5-diethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCC1(CC)C(=O)NC(=O)N(C(=O)C(O)CO)C1=O |
| InChI | InChI=1S/C11H16N2O6/c1-3-11(4-2)8(17)12-10(19)13(9(11)18)7(16)6(15)5-14/h6,14-15H,3-5H2,1-2H3,(H,12,17,19) |
| InChIKey | AEVFSYZMOFEZSV-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|