2-(5-bromo-1,3-dioxoisoindol-2-yl)-5-methoxypentanoic acid

C14H14BrNO5 — CID 81086365

IUPAC2-(5-bromo-1,3-dioxoisoindol-2-yl)-5-methoxypentanoic acid
SMILESCOCCCC(C(=O)O)N1C(=O)c2ccc(Br)cc2C1=O
InChIInChI=1S/C14H14BrNO5/c1-21-6-2-3-11(14(19)20)16-12(17)9-5-4-8(15)7-10(9)13(16)18/h4-5,7,11H,2-3,6H2,1H3,(H,19,20)
InChIKeyIYSWRNBRPWTIJA-UHFFFAOYSA-N
MW356.17 g/mol
LogP1.92
Rot. Bonds6

About 2-(5-bromo-1,3-dioxoisoindol-2-yl)-5-methoxypentanoic acid

2-(5-bromo-1,3-dioxoisoindol-2-yl)-5-methoxypentanoic acid (PubChem CID 81086365) has the molecular formula C14H14BrNO5 and a molecular weight of 356.17 g/mol. Its IUPAC name is 2-(5-bromo-1,3-dioxoisoindol-2-yl)-5-methoxypentanoic acid.

Molecular Properties

Compound Name2-(5-bromo-1,3-dioxoisoindol-2-yl)-5-methoxypentanoic acid
PubChem CID81086365
Molecular FormulaC14H14BrNO5
Molecular Weight356.17 g/mol
Exact Mass355.01
IUPAC Name2-(5-bromo-1,3-dioxoisoindol-2-yl)-5-methoxypentanoic acid
SMILESCOCCCC(C(=O)O)N1C(=O)c2ccc(Br)cc2C1=O
InChIInChI=1S/C14H14BrNO5/c1-21-6-2-3-11(14(19)20)16-12(17)9-5-4-8(15)7-10(9)13(16)18/h4-5,7,11H,2-3,6H2,1H3,(H,19,20)
InChIKeyIYSWRNBRPWTIJA-UHFFFAOYSA-N
XLogP1.92
TPSA83.91 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500356.17
LogP ≤ 51.92
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 2-(5-bromo-1,3-dioxoisoindol-2-yl)-5-methoxypentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-bromo-1,3-dioxoisoindol-2-yl)-5-methoxypentanoic acid?
The IUPAC name of 2-(5-bromo-1,3-dioxoisoindol-2-yl)-5-methoxypentanoic acid (CID 81086365) is 2-(5-bromo-1,3-dioxoisoindol-2-yl)-5-methoxypentanoic acid.
What is the SMILES notation for 2-(5-bromo-1,3-dioxoisoindol-2-yl)-5-methoxypentanoic acid?
The canonical SMILES for 2-(5-bromo-1,3-dioxoisoindol-2-yl)-5-methoxypentanoic acid is COCCCC(C(=O)O)N1C(=O)c2ccc(Br)cc2C1=O.
What is the InChIKey of 2-(5-bromo-1,3-dioxoisoindol-2-yl)-5-methoxypentanoic acid?
The InChIKey is IYSWRNBRPWTIJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BrNO5/c1-21-6-2-3-11(14(19)20)16-12(17)9-5-4-8(15)7-10(9)13(16)18/h4-5,7,11H,2-3,6H2,1H3,(H,19,20).
What are the key properties of 2-(5-bromo-1,3-dioxoisoindol-2-yl)-5-methoxypentanoic acid?
2-(5-bromo-1,3-dioxoisoindol-2-yl)-5-methoxypentanoic acid has a molecular weight of 356.17 g/mol, XLogP of 1.92, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromo-1,3-dioxoisoindol-2-yl)-5-methoxypentanoic acid is sourced from PubChem (CID 81086365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).