C14H14BrNO5 — CID 81086365
2-(5-bromo-1,3-dioxoisoindol-2-yl)-5-methoxypentanoic acid (PubChem CID 81086365) has the molecular formula C14H14BrNO5 and a molecular weight of 356.17 g/mol. Its IUPAC name is 2-(5-bromo-1,3-dioxoisoindol-2-yl)-5-methoxypentanoic acid.
| Compound Name | 2-(5-bromo-1,3-dioxoisoindol-2-yl)-5-methoxypentanoic acid |
|---|---|
| PubChem CID | 81086365 |
| Molecular Formula | C14H14BrNO5 |
| Molecular Weight | 356.17 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | 2-(5-bromo-1,3-dioxoisoindol-2-yl)-5-methoxypentanoic acid |
| SMILES | COCCCC(C(=O)O)N1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C14H14BrNO5/c1-21-6-2-3-11(14(19)20)16-12(17)9-5-4-8(15)7-10(9)13(16)18/h4-5,7,11H,2-3,6H2,1H3,(H,19,20) |
| InChIKey | IYSWRNBRPWTIJA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.17 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|