About O-(1,3-dioxoisoindol-2-yl) benzenecarbothioate
O-(1,3-dioxoisoindol-2-yl) benzenecarbothioate (PubChem CID 175000687) has the molecular formula C15H9NO3S
and a molecular weight of 283.31 g/mol. Its IUPAC name is O-(1,3-dioxoisoindol-2-yl) benzenecarbothioate.
Molecular Properties
| Compound Name | O-(1,3-dioxoisoindol-2-yl) benzenecarbothioate |
| PubChem CID | 175000687 |
| Molecular Formula | C15H9NO3S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | O-(1,3-dioxoisoindol-2-yl) benzenecarbothioate |
| SMILES | O=C1c2ccccc2C(=O)N1OC(=S)c1ccccc1 |
| InChI | InChI=1S/C15H9NO3S/c17-13-11-8-4-5-9-12(11)14(18)16(13)19-15(20)10-6-2-1-3-7-10/h1-9H |
| InChIKey | FRJQFOIFSBTAJG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(1,3-dioxoisoindol-2-yl) benzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(1,3-dioxoisoindol-2-yl) benzenecarbothioate?
The IUPAC name of O-(1,3-dioxoisoindol-2-yl) benzenecarbothioate (CID 175000687) is O-(1,3-dioxoisoindol-2-yl) benzenecarbothioate.
What is the SMILES notation for O-(1,3-dioxoisoindol-2-yl) benzenecarbothioate?
The canonical SMILES for O-(1,3-dioxoisoindol-2-yl) benzenecarbothioate is O=C1c2ccccc2C(=O)N1OC(=S)c1ccccc1.
What is the InChIKey of O-(1,3-dioxoisoindol-2-yl) benzenecarbothioate?
The InChIKey is FRJQFOIFSBTAJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9NO3S/c17-13-11-8-4-5-9-12(11)14(18)16(13)19-15(20)10-6-2-1-3-7-10/h1-9H.
What are the key properties of O-(1,3-dioxoisoindol-2-yl) benzenecarbothioate?
O-(1,3-dioxoisoindol-2-yl) benzenecarbothioate has a molecular weight of 283.31 g/mol, XLogP of 2.59, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-(1,3-dioxoisoindol-2-yl) benzenecarbothioate is sourced from PubChem (CID 175000687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).