C25H18ClNO6 — CID 168720333
(1,3-dioxoisoindol-2-yl) 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate (PubChem CID 168720333) has the molecular formula C25H18ClNO6 and a molecular weight of 463.87 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl) 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate.
| Compound Name | (1,3-dioxoisoindol-2-yl) 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 168720333 |
| Molecular Formula | C25H18ClNO6 |
| Molecular Weight | 463.87 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl) 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate |
| SMILES | CC(C)(Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1)C(=O)ON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H18ClNO6/c1-25(2,24(31)33-27-22(29)19-5-3-4-6-20(19)23(27)30)32-18-13-9-16(10-14-18)21(28)15-7-11-17(26)12-8-15/h3-14H,1-2H3 |
| InChIKey | BUZMYTMDHHBCPL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.87 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|