About 9-bromononyl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate
9-bromononyl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate (PubChem CID 141493265) has the molecular formula C26H32BrClO4
and a molecular weight of 523.90 g/mol. Its IUPAC name is 9-bromononyl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate.
Molecular Properties
| Compound Name | 9-bromononyl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate |
| PubChem CID | 141493265 |
| Molecular Formula | C26H32BrClO4 |
| Molecular Weight | 523.90 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | 9-bromononyl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate |
| SMILES | CC(C)(Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1)C(=O)OCCCCCCCCCBr |
| InChI | InChI=1S/C26H32BrClO4/c1-26(2,25(30)31-19-9-7-5-3-4-6-8-18-27)32-23-16-12-21(13-17-23)24(29)20-10-14-22(28)15-11-20/h10-17H,3-9,18-19H2,1-2H3 |
| InChIKey | PHASHMMJOZMIIN-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 523.90 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 9-bromononyl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bromononyl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate?
The IUPAC name of 9-bromononyl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate (CID 141493265) is 9-bromononyl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate.
What is the SMILES notation for 9-bromononyl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate?
The canonical SMILES for 9-bromononyl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate is CC(C)(Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1)C(=O)OCCCCCCCCCBr.
What is the InChIKey of 9-bromononyl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate?
The InChIKey is PHASHMMJOZMIIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32BrClO4/c1-26(2,25(30)31-19-9-7-5-3-4-6-8-18-27)32-23-16-12-21(13-17-23)24(29)20-10-14-22(28)15-11-20/h10-17H,3-9,18-19H2,1-2H3.
What are the key properties of 9-bromononyl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate?
9-bromononyl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate has a molecular weight of 523.90 g/mol, XLogP of 7.40, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bromononyl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate is sourced from PubChem (CID 141493265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).