C22H26ClNO6 — CID 89219256
4-(dihydroxyamino)oxybutyl 2-[4-[1-(4-chlorophenyl)ethenyl]phenoxy]-2-methylpropanoate (PubChem CID 89219256) has the molecular formula C22H26ClNO6 and a molecular weight of 435.90 g/mol. Its IUPAC name is 4-(dihydroxyamino)oxybutyl 2-[4-[1-(4-chlorophenyl)ethenyl]phenoxy]-2-methylpropanoate.
| Compound Name | 4-(dihydroxyamino)oxybutyl 2-[4-[1-(4-chlorophenyl)ethenyl]phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 89219256 |
| Molecular Formula | C22H26ClNO6 |
| Molecular Weight | 435.90 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 4-(dihydroxyamino)oxybutyl 2-[4-[1-(4-chlorophenyl)ethenyl]phenoxy]-2-methylpropanoate |
| SMILES | C=C(c1ccc(Cl)cc1)c1ccc(OC(C)(C)C(=O)OCCCCON(O)O)cc1 |
| InChI | InChI=1S/C22H26ClNO6/c1-16(17-6-10-19(23)11-7-17)18-8-12-20(13-9-18)30-22(2,3)21(25)28-14-4-5-15-29-24(26)27/h6-13,26-27H,1,4-5,14-15H2,2-3H3 |
| InChIKey | IXYPQCXBPXJXLF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.90 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|