C23H38O2 — CID 155129067
3-phenylpentan-3-yl 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 155129067) has the molecular formula C23H38O2 and a molecular weight of 346.56 g/mol. Its IUPAC name is 3-phenylpentan-3-yl 2-tert-butyl-2,4,4-trimethylpentanoate.
| Compound Name | 3-phenylpentan-3-yl 2-tert-butyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 155129067 |
| Molecular Formula | C23H38O2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.29 |
| IUPAC Name | 3-phenylpentan-3-yl 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | CCC(CC)(OC(=O)C(C)(CC(C)(C)C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C23H38O2/c1-10-23(11-2,18-15-13-12-14-16-18)25-19(24)22(9,21(6,7)8)17-20(3,4)5/h12-16H,10-11,17H2,1-9H3 |
| InChIKey | MIKKRBDBAVJPQG-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |