C26H26N2O8 — CID 87902888
(13-hexanoyloxy-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl) hexanoate (PubChem CID 87902888) has the molecular formula C26H26N2O8 and a molecular weight of 494.50 g/mol. Its IUPAC name is (13-hexanoyloxy-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl) hexanoate.
| Compound Name | (13-hexanoyloxy-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl) hexanoate |
|---|---|
| PubChem CID | 87902888 |
| Molecular Formula | C26H26N2O8 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | (13-hexanoyloxy-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl) hexanoate |
| SMILES | CCCCCC(=O)ON1C(=O)c2ccc3c4c(ccc(c24)C1=O)C(=O)N(OC(=O)CCCCC)C3=O |
| InChI | InChI=1S/C26H26N2O8/c1-3-5-7-9-19(29)35-27-23(31)15-11-13-17-22-18(14-12-16(21(15)22)24(27)32)26(34)28(25(17)33)36-20(30)10-8-6-4-2/h11-14H,3-10H2,1-2H3 |
| InChIKey | WVZSSBAZORRLGE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|