C37H32N2O6 — CID 140789743
(11,22-dimethyl-18-octyl-6,8,17,19-tetraoxo-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaen-7-yl) prop-2-enoate (PubChem CID 140789743) has the molecular formula C37H32N2O6 and a molecular weight of 600.67 g/mol. Its IUPAC name is (11,22-dimethyl-18-octyl-6,8,17,19-tetraoxo-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaen-7-yl) prop-2-enoate.
| Compound Name | (11,22-dimethyl-18-octyl-6,8,17,19-tetraoxo-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaen-7-yl) prop-2-enoate |
|---|---|
| PubChem CID | 140789743 |
| Molecular Formula | C37H32N2O6 |
| Molecular Weight | 600.67 g/mol |
| Exact Mass | 600.23 |
| IUPAC Name | (11,22-dimethyl-18-octyl-6,8,17,19-tetraoxo-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaen-7-yl) prop-2-enoate |
| SMILES | C=CC(=O)ON1C(=O)c2ccc3c4c(C)cc5c6c(ccc(c7c(C)cc(c2c37)C1=O)c64)C(=O)N(CCCCCCCC)C5=O |
| InChI | InChI=1S/C37H32N2O6/c1-5-7-8-9-10-11-16-38-34(41)23-14-12-21-29-20(4)18-26-31-24(36(43)39(37(26)44)45-27(40)6-2)15-13-22(33(29)31)28-19(3)17-25(35(38)42)30(23)32(21)28/h6,12-15,17-18H,2,5,7-11,16H2,1,3-4H3 |
| InChIKey | KSQJYCPHCGILDD-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.67 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|