C31H23FN2O4 — CID 118055377
7-butyl-18-ethyl-22-fluoro-11-methyl-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17,19-tetrone (PubChem CID 118055377) has the molecular formula C31H23FN2O4 and a molecular weight of 506.53 g/mol. Its IUPAC name is 7-butyl-18-ethyl-22-fluoro-11-methyl-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17,19-tetrone.
| Compound Name | 7-butyl-18-ethyl-22-fluoro-11-methyl-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17,19-tetrone |
|---|---|
| PubChem CID | 118055377 |
| Molecular Formula | C31H23FN2O4 |
| Molecular Weight | 506.53 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | 7-butyl-18-ethyl-22-fluoro-11-methyl-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17,19-tetrone |
| SMILES | CCCCN1C(=O)c2ccc3c4c(F)cc5c6c(ccc(c7c(C)cc(c2c37)C1=O)c64)C(=O)N(CC)C5=O |
| InChI | InChI=1S/C31H23FN2O4/c1-4-6-11-34-29(36)18-10-8-16-25-21(32)13-20-24-17(28(35)33(5-2)30(20)37)9-7-15(27(24)25)22-14(3)12-19(31(34)38)23(18)26(16)22/h7-10,12-13H,4-6,11H2,1-3H3 |
| InChIKey | ONBGSVYEWUZIBM-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.53 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|