C21H24N6O4 — CID 25151476
2-[(9-oxo-6-phenyl-5H-imidazo[1,2-a]purin-3-yl)methoxy]ethyl (2R)-2-amino-3-methylbutanoate (PubChem CID 25151476) has the molecular formula C21H24N6O4 and a molecular weight of 424.46 g/mol. Its IUPAC name is 2-[(9-oxo-6-phenyl-5H-imidazo[1,2-a]purin-3-yl)methoxy]ethyl (2R)-2-amino-3-methylbutanoate.
| Compound Name | 2-[(9-oxo-6-phenyl-5H-imidazo[1,2-a]purin-3-yl)methoxy]ethyl (2R)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 25151476 |
| Molecular Formula | C21H24N6O4 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 2-[(9-oxo-6-phenyl-5H-imidazo[1,2-a]purin-3-yl)methoxy]ethyl (2R)-2-amino-3-methylbutanoate |
| SMILES | CC(C)[C@@H](N)C(=O)OCCOCn1cnc2c(=O)n3cc(-c4ccccc4)[nH]c3nc21 |
| InChI | InChI=1S/C21H24N6O4/c1-13(2)16(22)20(29)31-9-8-30-12-26-11-23-17-18(26)25-21-24-15(10-27(21)19(17)28)14-6-4-3-5-7-14/h3-7,10-11,13,16H,8-9,12,22H2,1-2H3,(H,24,25)/t16-/m1/s1 |
| InChIKey | FFNMBFLRDZWXQV-MRXNPFEDSA-N |
| XLogP | 1.54 |
| TPSA | 129.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|