C16H25N7O5 — CID 135912074
2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-methylbutanoate (PubChem CID 135912074) has the molecular formula C16H25N7O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is 2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-methylbutanoate.
| Compound Name | 2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 135912074 |
| Molecular Formula | C16H25N7O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)[C@H](C)N)C(=O)OCCOCn1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C16H25N7O5/c1-8(2)10(20-13(24)9(3)17)15(26)28-5-4-27-7-23-6-19-11-12(23)21-16(18)22-14(11)25/h6,8-10H,4-5,7,17H2,1-3H3,(H,20,24)(H3,18,21,22,25)/t9-,10-/m0/s1 |
| InChIKey | CQMOAGPXMWFGDX-UWVGGRQHSA-N |
| XLogP | -1.29 |
| TPSA | 180.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|