C18H29N7O5 — CID 135434076
2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethyl (2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-methylbutanoate (PubChem CID 135434076) has the molecular formula C18H29N7O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is 2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethyl (2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-methylbutanoate.
| Compound Name | 2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethyl (2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 135434076 |
| Molecular Formula | C18H29N7O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethyl (2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](N)C(=O)N[C@H](C(=O)OCCOCn1cnc2c(=O)[nH]c(N)nc21)C(C)C |
| InChI | InChI=1S/C18H29N7O5/c1-9(2)11(19)15(26)22-12(10(3)4)17(28)30-6-5-29-8-25-7-21-13-14(25)23-18(20)24-16(13)27/h7,9-12H,5-6,8,19H2,1-4H3,(H,22,26)(H3,20,23,24,27)/t11-,12-/m0/s1 |
| InChIKey | VMIZCIUWRNDLSW-RYUDHWBXSA-N |
| XLogP | -0.66 |
| TPSA | 180.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|