C14H21N5O4 — CID 135465921
2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethyl hexanoate (PubChem CID 135465921) has the molecular formula C14H21N5O4 and a molecular weight of 323.35 g/mol. Its IUPAC name is 2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethyl hexanoate.
| Compound Name | 2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethyl hexanoate |
|---|---|
| PubChem CID | 135465921 |
| Molecular Formula | C14H21N5O4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethyl hexanoate |
| SMILES | CCCCCC(=O)OCCOCn1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C14H21N5O4/c1-2-3-4-5-10(20)23-7-6-22-9-19-8-16-11-12(19)17-14(15)18-13(11)21/h8H,2-7,9H2,1H3,(H3,15,17,18,21) |
| InChIKey | SLVUVSMVSSTFHH-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|