C24H35N7O7S — CID 135859884
2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethyl 6-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyloxy]hexanoate (PubChem CID 135859884) has the molecular formula C24H35N7O7S and a molecular weight of 565.65 g/mol. Its IUPAC name is 2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethyl 6-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyloxy]hexanoate.
| Compound Name | 2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethyl 6-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyloxy]hexanoate |
|---|---|
| PubChem CID | 135859884 |
| Molecular Formula | C24H35N7O7S |
| Molecular Weight | 565.65 g/mol |
| Exact Mass | 565.23 |
| IUPAC Name | 2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethyl 6-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyloxy]hexanoate |
| SMILES | Nc1nc2c(ncn2COCCOC(=O)CCCCCOC(=O)CCCCC2SC[C@@H]3NC(=O)N[C@H]23)c(=O)[nH]1 |
| InChI | InChI=1S/C24H35N7O7S/c25-23-29-21-20(22(34)30-23)26-13-31(21)14-36-10-11-38-18(33)7-2-1-5-9-37-17(32)8-4-3-6-16-19-15(12-39-16)27-24(35)28-19/h13,15-16,19H,1-12,14H2,(H2,27,28,35)(H3,25,29,30,34)/t15-,16?,19-/m0/s1 |
| InChIKey | NKTWRDNZGQEQAG-QLYZIHHJSA-N |
| XLogP | 1.05 |
| TPSA | 192.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.65 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|