C52H96N4O9S — CID 137470845
6-[3-[bis(3-octoxy-3-oxopropyl)amino]propyl-(3-octoxy-3-oxopropyl)amino]hexyl 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoate (PubChem CID 137470845) has the molecular formula C52H96N4O9S and a molecular weight of 953.43 g/mol. Its IUPAC name is 6-[3-[bis(3-octoxy-3-oxopropyl)amino]propyl-(3-octoxy-3-oxopropyl)amino]hexyl 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoate.
| Compound Name | 6-[3-[bis(3-octoxy-3-oxopropyl)amino]propyl-(3-octoxy-3-oxopropyl)amino]hexyl 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoate |
|---|---|
| PubChem CID | 137470845 |
| Molecular Formula | C52H96N4O9S |
| Molecular Weight | 953.43 g/mol |
| Exact Mass | 952.69 |
| IUPAC Name | 6-[3-[bis(3-octoxy-3-oxopropyl)amino]propyl-(3-octoxy-3-oxopropyl)amino]hexyl 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoate |
| SMILES | CCCCCCCCOC(=O)CCN(CCCCCCOC(=O)CCCCC1SCC2NC(=O)NC21)CCCN(CCC(=O)OCCCCCCCC)CCC(=O)OCCCCCCCC |
| InChI | InChI=1S/C52H96N4O9S/c1-4-7-10-13-17-24-41-63-48(58)31-37-55(34-23-16-20-27-40-62-47(57)30-22-21-29-46-51-45(44-66-46)53-52(61)54-51)35-28-36-56(38-32-49(59)64-42-25-18-14-11-8-5-2)39-33-50(60)65-43-26-19-15-12-9-6-3/h45-46,51H,4-44H2,1-3H3,(H2,53,54,61) |
| InChIKey | NHZYVCMHIDRACX-UHFFFAOYSA-N |
| XLogP | 10.69 |
| TPSA | 152.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 953.43 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|