C24H44N6O4S — CID 121260422
5-[5-[(3aS,4R,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]pentyl 6-(4-methyltriazolidin-1-yl)hexanoate (PubChem CID 121260422) has the molecular formula C24H44N6O4S and a molecular weight of 512.72 g/mol. Its IUPAC name is 5-[5-[(3aS,4R,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]pentyl 6-(4-methyltriazolidin-1-yl)hexanoate.
| Compound Name | 5-[5-[(3aS,4R,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]pentyl 6-(4-methyltriazolidin-1-yl)hexanoate |
|---|---|
| PubChem CID | 121260422 |
| Molecular Formula | C24H44N6O4S |
| Molecular Weight | 512.72 g/mol |
| Exact Mass | 512.31 |
| IUPAC Name | 5-[5-[(3aS,4R,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]pentyl 6-(4-methyltriazolidin-1-yl)hexanoate |
| SMILES | CC1CN(CCCCCC(=O)OCCCCCNC(=O)CCCC[C@H]2SC[C@@H]3NC(=O)N[C@@H]32)NN1 |
| InChI | InChI=1S/C24H44N6O4S/c1-18-16-30(29-28-18)14-8-2-4-12-22(32)34-15-9-3-7-13-25-21(31)11-6-5-10-20-23-19(17-35-20)26-24(33)27-23/h18-20,23,28-29H,2-17H2,1H3,(H,25,31)(H2,26,27,33)/t18?,19-,20+,23-/m0/s1 |
| InChIKey | LSKYSKXSAQOXMW-CRHVVPOVSA-N |
| XLogP | 1.82 |
| TPSA | 123.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.72 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|