C12H26N2OS — CID 157349030
(3aS,4S,6aR)-4-pentyl-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;methane (PubChem CID 157349030) has the molecular formula C12H26N2OS and a molecular weight of 246.42 g/mol. Its IUPAC name is (3aS,4S,6aR)-4-pentyl-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;methane.
| Compound Name | (3aS,4S,6aR)-4-pentyl-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;methane |
|---|---|
| PubChem CID | 157349030 |
| Molecular Formula | C12H26N2OS |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | (3aS,4S,6aR)-4-pentyl-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;methane |
| SMILES | C.C.CCCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C10H18N2OS.2CH4/c1-2-3-4-5-8-9-7(6-14-8)11-10(13)12-9;;/h7-9H,2-6H2,1H3,(H2,11,12,13);2*1H4/t7-,8-,9-;;/m0../s1 |
| InChIKey | BHHRGFZYEJTJCT-BFSQVDHHSA-N |
| XLogP | 3.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|