C14H25N3O3S2 — CID 171776028
[ethyl(2-sulfanylethyl)amino] 5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate (PubChem CID 171776028) has the molecular formula C14H25N3O3S2 and a molecular weight of 347.51 g/mol. Its IUPAC name is [ethyl(2-sulfanylethyl)amino] 5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate.
| Compound Name | [ethyl(2-sulfanylethyl)amino] 5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
|---|---|
| PubChem CID | 171776028 |
| Molecular Formula | C14H25N3O3S2 |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | [ethyl(2-sulfanylethyl)amino] 5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
| SMILES | CCN(CCS)OC(=O)CCCC[C@H]1SC[C@H]2NC(=O)N[C@H]21 |
| InChI | InChI=1S/C14H25N3O3S2/c1-2-17(7-8-21)20-12(18)6-4-3-5-11-13-10(9-22-11)15-14(19)16-13/h10-11,13,21H,2-9H2,1H3,(H2,15,16,19)/t10-,11-,13-/m1/s1 |
| InChIKey | MVIFZPGQRRUCIR-NQBHXWOUSA-N |
| XLogP | 1.42 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|