C18H27N9O5S2 — CID 122212858
N-[2-[(6-aminopurin-9-yl)methoxy]ethylsulfamoyl]-5-[(4R)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanamide (PubChem CID 122212858) has the molecular formula C18H27N9O5S2 and a molecular weight of 513.61 g/mol. Its IUPAC name is N-[2-[(6-aminopurin-9-yl)methoxy]ethylsulfamoyl]-5-[(4R)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanamide.
| Compound Name | N-[2-[(6-aminopurin-9-yl)methoxy]ethylsulfamoyl]-5-[(4R)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanamide |
|---|---|
| PubChem CID | 122212858 |
| Molecular Formula | C18H27N9O5S2 |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | N-[2-[(6-aminopurin-9-yl)methoxy]ethylsulfamoyl]-5-[(4R)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanamide |
| SMILES | Nc1ncnc2c1ncn2COCCNS(=O)(=O)NC(=O)CCCC[C@H]1SCC2NC(=O)NC21 |
| InChI | InChI=1S/C18H27N9O5S2/c19-16-15-17(21-8-20-16)27(9-22-15)10-32-6-5-23-34(30,31)26-13(28)4-2-1-3-12-14-11(7-33-12)24-18(29)25-14/h8-9,11-12,14,23H,1-7,10H2,(H,26,28)(H2,19,20,21)(H2,24,25,29)/t11?,12-,14?/m1/s1 |
| InChIKey | HEOBKFIXAMLSMW-MBHSVXNSSA-N |
| XLogP | -0.94 |
| TPSA | 195.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|