C21H30N8O7S2 — CID 86579462
N-[2-[(3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethylsulfonyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (PubChem CID 86579462) has the molecular formula C21H30N8O7S2 and a molecular weight of 570.65 g/mol. Its IUPAC name is N-[2-[(3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethylsulfonyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide.
| Compound Name | N-[2-[(3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethylsulfonyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
|---|---|
| PubChem CID | 86579462 |
| Molecular Formula | C21H30N8O7S2 |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.17 |
| IUPAC Name | N-[2-[(3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethylsulfonyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1OC(CCS(=O)(=O)NC(=O)CCCCC2SCC3NC(=O)NC32)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H30N8O7S2/c22-18-15-19(24-8-23-18)29(9-25-15)20-17(32)16(31)11(36-20)5-6-38(34,35)28-13(30)4-2-1-3-12-14-10(7-37-12)26-21(33)27-14/h8-12,14,16-17,20,31-32H,1-7H2,(H,28,30)(H2,22,23,24)(H2,26,27,33)/t10?,11?,12?,14?,16-,17-,20-/m1/s1 |
| InChIKey | YYHQCDVJYDHIQC-YSFSPWSLSA-N |
| XLogP | -1.41 |
| TPSA | 223.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|