C21H30N7O9PS — CID 163482237
[[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-methoxyphosphoryl] 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoate (PubChem CID 163482237) has the molecular formula C21H30N7O9PS and a molecular weight of 587.55 g/mol. Its IUPAC name is [[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-methoxyphosphoryl] 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoate.
| Compound Name | [[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-methoxyphosphoryl] 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoate |
|---|---|
| PubChem CID | 163482237 |
| Molecular Formula | C21H30N7O9PS |
| Molecular Weight | 587.55 g/mol |
| Exact Mass | 587.16 |
| IUPAC Name | [[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-methoxyphosphoryl] 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoate |
| SMILES | COP(=O)(OCC1OC(n2cnc3c(N)ncnc32)C(O)C1O)OC(=O)CCCCC1SCC2NC(=O)NC21 |
| InChI | InChI=1S/C21H30N7O9PS/c1-34-38(33,37-13(29)5-3-2-4-12-14-10(7-39-12)26-21(32)27-14)35-6-11-16(30)17(31)20(36-11)28-9-25-15-18(22)23-8-24-19(15)28/h8-12,14,16-17,20,30-31H,2-7H2,1H3,(H2,22,23,24)(H2,26,27,32) |
| InChIKey | CFNTZBCFHHTEFW-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 222.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.55 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|