C21H30N7O8PS — CID 118722121
[6-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-2-oxohexyl]-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]phosphinic acid (PubChem CID 118722121) has the molecular formula C21H30N7O8PS and a molecular weight of 571.55 g/mol. Its IUPAC name is [6-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-2-oxohexyl]-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]phosphinic acid.
| Compound Name | [6-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-2-oxohexyl]-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]phosphinic acid |
|---|---|
| PubChem CID | 118722121 |
| Molecular Formula | C21H30N7O8PS |
| Molecular Weight | 571.55 g/mol |
| Exact Mass | 571.16 |
| IUPAC Name | [6-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-2-oxohexyl]-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]phosphinic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)CC(=O)CCCC[C@@H]2SC[C@@H]3NC(=O)N[C@@H]32)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H30N7O8PS/c22-18-15-19(24-8-23-18)28(9-25-15)20-17(31)16(30)12(36-20)5-35-37(33,34)6-10(29)3-1-2-4-13-14-11(7-38-13)26-21(32)27-14/h8-9,11-14,16-17,20,30-31H,1-7H2,(H,33,34)(H2,22,23,24)(H2,26,27,32)/t11-,12+,13-,14-,16+,17+,20+/m0/s1 |
| InChIKey | QICGQTVIIQQAIN-VWULNXFCSA-N |
| XLogP | -0.48 |
| TPSA | 224.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.55 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|