C26H41N8O9PS — CID 72968833
[3,4-dihydroxy-5-[6-[6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexylamino]purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 72968833) has the molecular formula C26H41N8O9PS and a molecular weight of 672.70 g/mol. Its IUPAC name is [3,4-dihydroxy-5-[6-[6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexylamino]purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [3,4-dihydroxy-5-[6-[6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexylamino]purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 72968833 |
| Molecular Formula | C26H41N8O9PS |
| Molecular Weight | 672.70 g/mol |
| Exact Mass | 672.25 |
| IUPAC Name | [3,4-dihydroxy-5-[6-[6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexylamino]purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=C(CCCCC1SCC2NC(=O)NC21)NCCCCCCNc1ncnc2c1ncn2C1OC(COP(=O)(O)O)C(O)C1O |
| InChI | InChI=1S/C26H41N8O9PS/c35-18(8-4-3-7-17-19-15(12-45-17)32-26(38)33-19)27-9-5-1-2-6-10-28-23-20-24(30-13-29-23)34(14-31-20)25-22(37)21(36)16(43-25)11-42-44(39,40)41/h13-17,19,21-22,25,36-37H,1-12H2,(H,27,35)(H,28,29,30)(H2,32,33,38)(H2,39,40,41) |
| InChIKey | JHPPUZXTSWNMKQ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 242.31 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.70 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|