C20H27N7O6S — CID 162472545
[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate (PubChem CID 162472545) has the molecular formula C20H27N7O6S and a molecular weight of 493.55 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate.
| Compound Name | [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
|---|---|
| PubChem CID | 162472545 |
| Molecular Formula | C20H27N7O6S |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COC(=O)CCCC[C@@H]2SC[C@@H]3NC(=O)N[C@@H]32)[C@@H](O)C1O |
| InChI | InChI=1S/C20H27N7O6S/c21-17-14-18(23-7-22-17)27(8-24-14)19-16(30)15(29)10(33-19)5-32-12(28)4-2-1-3-11-13-9(6-34-11)25-20(31)26-13/h7-11,13,15-16,19,29-30H,1-6H2,(H2,21,22,23)(H2,25,26,31)/t9-,10+,11-,13-,15+,16?,19+/m0/s1 |
| InChIKey | QIFNVGOCKHOVAC-PDAOHQICSA-N |
| XLogP | -0.70 |
| TPSA | 186.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|