C19H26N10OS — CID 71535903
(3aS,4S,6aR)-4-[5-[1-[2-(6-aminopurin-9-yl)ethyl]triazol-4-yl]pentyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one (PubChem CID 71535903) has the molecular formula C19H26N10OS and a molecular weight of 442.55 g/mol. Its IUPAC name is (3aS,4S,6aR)-4-[5-[1-[2-(6-aminopurin-9-yl)ethyl]triazol-4-yl]pentyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one.
| Compound Name | (3aS,4S,6aR)-4-[5-[1-[2-(6-aminopurin-9-yl)ethyl]triazol-4-yl]pentyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 71535903 |
| Molecular Formula | C19H26N10OS |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | (3aS,4S,6aR)-4-[5-[1-[2-(6-aminopurin-9-yl)ethyl]triazol-4-yl]pentyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
| SMILES | Nc1ncnc2c1ncn2CCn1cc(CCCCC[C@@H]2SC[C@@H]3NC(=O)N[C@@H]32)nn1 |
| InChI | InChI=1S/C19H26N10OS/c20-17-16-18(22-10-21-17)28(11-23-16)6-7-29-8-12(26-27-29)4-2-1-3-5-14-15-13(9-31-14)24-19(30)25-15/h8,10-11,13-15H,1-7,9H2,(H2,20,21,22)(H2,24,25,30)/t13-,14-,15-/m0/s1 |
| InChIKey | LAXINFVFLZRMFR-KKUMJFAQSA-N |
| XLogP | 0.97 |
| TPSA | 141.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|