C20H27N7O5S — CID 166820485
[(E,3S)-4-(6-aminopurin-9-yl)-3-hydroxy-4-methoxybut-1-enyl] 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate (PubChem CID 166820485) has the molecular formula C20H27N7O5S and a molecular weight of 477.55 g/mol. Its IUPAC name is [(E,3S)-4-(6-aminopurin-9-yl)-3-hydroxy-4-methoxybut-1-enyl] 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate.
| Compound Name | [(E,3S)-4-(6-aminopurin-9-yl)-3-hydroxy-4-methoxybut-1-enyl] 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
|---|---|
| PubChem CID | 166820485 |
| Molecular Formula | C20H27N7O5S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | [(E,3S)-4-(6-aminopurin-9-yl)-3-hydroxy-4-methoxybut-1-enyl] 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
| SMILES | COC([C@@H](O)/C=C/OC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C20H27N7O5S/c1-31-19(27-10-24-16-17(21)22-9-23-18(16)27)12(28)6-7-32-14(29)5-3-2-4-13-15-11(8-33-13)25-20(30)26-15/h6-7,9-13,15,19,28H,2-5,8H2,1H3,(H2,21,22,23)(H2,25,26,30)/b7-6+/t11-,12-,13-,15-,19?/m0/s1 |
| InChIKey | HJBDVUYLEBHHRP-IAZIUDFOSA-N |
| XLogP | 0.70 |
| TPSA | 166.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|