C18H16F3N5O3 — CID 5276654
3-(2-hydroxyethoxymethyl)-7-methyl-6-[4-(trifluoromethyl)phenyl]-5H-imidazo[1,2-a]purin-9-one (PubChem CID 5276654) has the molecular formula C18H16F3N5O3 and a molecular weight of 407.35 g/mol. Its IUPAC name is 3-(2-hydroxyethoxymethyl)-7-methyl-6-[4-(trifluoromethyl)phenyl]-5H-imidazo[1,2-a]purin-9-one.
| Compound Name | 3-(2-hydroxyethoxymethyl)-7-methyl-6-[4-(trifluoromethyl)phenyl]-5H-imidazo[1,2-a]purin-9-one |
|---|---|
| PubChem CID | 5276654 |
| Molecular Formula | C18H16F3N5O3 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 3-(2-hydroxyethoxymethyl)-7-methyl-6-[4-(trifluoromethyl)phenyl]-5H-imidazo[1,2-a]purin-9-one |
| SMILES | Cc1c(-c2ccc(C(F)(F)F)cc2)[nH]c2nc3c(ncn3COCCO)c(=O)n12 |
| InChI | InChI=1S/C18H16F3N5O3/c1-10-13(11-2-4-12(5-3-11)18(19,20)21)23-17-24-15-14(16(28)26(10)17)22-8-25(15)9-29-7-6-27/h2-5,8,27H,6-7,9H2,1H3,(H,23,24) |
| InChIKey | CCUAAFSWMLJKDR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|