C8H12N5O6P — CID 70980906
[2-amino-9-(2-hydroxyethoxymethyl)-6-oxopurin-1-yl]phosphonic acid (PubChem CID 70980906) has the molecular formula C8H12N5O6P and a molecular weight of 305.19 g/mol. Its IUPAC name is [2-amino-9-(2-hydroxyethoxymethyl)-6-oxopurin-1-yl]phosphonic acid.
| Compound Name | [2-amino-9-(2-hydroxyethoxymethyl)-6-oxopurin-1-yl]phosphonic acid |
|---|---|
| PubChem CID | 70980906 |
| Molecular Formula | C8H12N5O6P |
| Molecular Weight | 305.19 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | [2-amino-9-(2-hydroxyethoxymethyl)-6-oxopurin-1-yl]phosphonic acid |
| SMILES | Nc1nc2c(ncn2COCCO)c(=O)n1P(=O)(O)O |
| InChI | InChI=1S/C8H12N5O6P/c9-8-11-6-5(7(15)13(8)20(16,17)18)10-3-12(6)4-19-2-1-14/h3,14H,1-2,4H2,(H2,9,11)(H2,16,17,18) |
| InChIKey | VJCOJSMJNYDMQW-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 165.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.19 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|